Products 1219798-91-0
CAS 1219798-91-0 appears in our catalog under these names: Methyl Octanoate-d15, Methyl Octanoate-d15, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 0,25g, 0,1g, 250mg, 100mg, 5 mg.
Methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecadeuteriooctanoate (CAS 1219798-91-0) is a chemical compound with the molecular formula C9H18O2 and a molecular weight of 173.33 g/mol. IUPAC name: methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecadeuteriooctanoate. InChIKey: JGHZJRVDZXSNKQ-KBZGSAGRSA-N.
| Molecular formula | C9H18O2 |
|---|---|
| Molecular weight | 173.33 g/mol |
| IUPAC name | methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecadeuteriooctanoate |
| InChIKey | JGHZJRVDZXSNKQ-KBZGSAGRSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)OC |
Computed by PubChem (NCBI)