Products 1219798-93-2
CAS 1219798-93-2 appears in our catalog under these names: 2-iso-Propyl-d7-5-methyl-d3-phenol-3,4,6-d3, 98 atom % D, min 98% Chemical Purity, 2-iso-Propyl-d7-5-methyl-d3-phenol-3,4,6-d3, >95% (HPLC), Thymol-d13, 98.73%. Offered by: CDN, TRC, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 2,5mg, 25mg, 5mg, 10 mg.
2,4,5-trideuterio-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-3-(trideuteriomethyl)phenol (CAS 1219798-93-2) is a chemical compound with the molecular formula C10H14O and a molecular weight of 163.30 g/mol. IUPAC name: 2,4,5-trideuterio-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-3-(trideuteriomethyl)phenol. InChIKey: MGSRCZKZVOBKFT-JPLVHWSDSA-N.
| Molecular formula | C10H14O |
|---|---|
| Molecular weight | 163.30 g/mol |
| IUPAC name | 2,4,5-trideuterio-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-3-(trideuteriomethyl)phenol |
| InChIKey | MGSRCZKZVOBKFT-JPLVHWSDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])O)C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)