CAS 1219798-96-5 appears in our catalog under these names: 4-Fluorobenzyl-2,3,5,6-d4-amine, 98 atom % D, min 98% Chemical Purity, p-Fluorobenzylamine-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
(2,3,5,6-tetradeuterio-4-fluorophenyl)methanamine (CAS 1219798-96-5) is a chemical compound with the molecular formula C7H8FN and a molecular weight of 129.17 g/mol. IUPAC name: (2,3,5,6-tetradeuterio-4-fluorophenyl)methanamine. InChIKey: IIFVWLUQBAIPMJ-RHQRLBAQSA-N.
| Molecular formula | C7H8FN |
|---|---|
| Molecular weight | 129.17 g/mol |
| IUPAC name | (2,3,5,6-tetradeuterio-4-fluorophenyl)methanamine |
| InChIKey | IIFVWLUQBAIPMJ-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CN)[2H])[2H])F)[2H] |
Computed by PubChem (NCBI)