CAS 1219799-05-9 appears in our catalog under these names: 3,5-Dibromopyridine-d3, 98 atom % D, min 98% Chemical Purity, 3,5-Dibromopyridine-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
3,5-dibromo-2,4,6-trideuteriopyridine (CAS 1219799-05-9) is a chemical compound with the molecular formula C5H3Br2N and a molecular weight of 239.91 g/mol. IUPAC name: 3,5-dibromo-2,4,6-trideuteriopyridine. InChIKey: SOSPMXMEOFGPIM-CBYSEHNBSA-N.
| Molecular formula | C5H3Br2N |
|---|---|
| Molecular weight | 239.91 g/mol |
| IUPAC name | 3,5-dibromo-2,4,6-trideuteriopyridine |
| InChIKey | SOSPMXMEOFGPIM-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1Br)[2H])[2H])Br |
Computed by PubChem (NCBI)