CAS 1219799-07-1 appears in our catalog under these names: 1-Phenylhexane-d5, n-Hexylbenzene-2,3,4,5,6-d5, 98 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, CDN. Available pack sizes: 1 mg, 1g, 0,5g.
1,2,3,4,5-pentadeuterio-6-hexylbenzene (CAS 1219799-07-1) is a chemical compound with the molecular formula C12H18 and a molecular weight of 167.30 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-hexylbenzene. InChIKey: LTEQMZWBSYACLV-SIHPLOMNSA-N.
| Molecular formula | C12H18 |
|---|---|
| Molecular weight | 167.30 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-hexylbenzene |
| InChIKey | LTEQMZWBSYACLV-SIHPLOMNSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CCCCCC)[2H])[2H] |
Computed by PubChem (NCBI)