Products 1219799-08-2
CAS 1219799-08-2 appears in our catalog under these names: 2-Bromobutanoic acid-d6, (±)-2-Bromobutyric-2,3,3,4,4,4-d6 Acid, 98 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, CDN. Available pack sizes: 1 mg, 0,5g, 0,25g.
2-bromo-2,3,3,4,4,4-hexadeuteriobutanoic acid (CAS 1219799-08-2) is a chemical compound with the molecular formula C4H7BrO2 and a molecular weight of 173.04 g/mol. IUPAC name: 2-bromo-2,3,3,4,4,4-hexadeuteriobutanoic acid. InChIKey: YAQLSKVCTLCIIE-LIDOUZCJSA-N.
| Molecular formula | C4H7BrO2 |
|---|---|
| Molecular weight | 173.04 g/mol |
| IUPAC name | 2-bromo-2,3,3,4,4,4-hexadeuteriobutanoic acid |
| InChIKey | YAQLSKVCTLCIIE-LIDOUZCJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])(C(=O)O)Br |
Computed by PubChem (NCBI)