CAS 1219799-10-6 appears in our catalog under these names: N–Butyrylglycine–d2, N-Butyrylglycine-2,2-d2, 98 atom % D, min 98% Chemical Purity, N-Butyrylglycine-d2, 99.17%. Offered by: GLPBio, CDN, MedChemExpress. Available pack sizes: 10mg, 0,1g, 0,05g, 5mg, 10 mg, 5 mg.
2-(butanoylamino)-2,2-dideuterioacetic acid (CAS 1219799-10-6) is a chemical compound with the molecular formula C6H11NO3 and a molecular weight of 147.17 g/mol. IUPAC name: 2-(butanoylamino)-2,2-dideuterioacetic acid. InChIKey: WPSSBBPLVMTKRN-APZFVMQVSA-N.
| Molecular formula | C6H11NO3 |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | 2-(butanoylamino)-2,2-dideuterioacetic acid |
| InChIKey | WPSSBBPLVMTKRN-APZFVMQVSA-N |
| SMILES | [2H]C([2H])(C(=O)O)NC(=O)CCC |
Computed by PubChem (NCBI)