Products 1219799-31-1
CAS 1219799-31-1 appears in our catalog under these names: 2-Furamide-3,4,5-d3, 98 atom % D, min 98% Chemical Purity, 2-Furamide-3,4,5-d3, Furan-2-carboxamide-d3. Offered by: CDN, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 100mg, 250mg, 1 mg.
3,4,5-trideuteriofuran-2-carboxamide (CAS 1219799-31-1) is a chemical compound with the molecular formula C5H5NO2 and a molecular weight of 114.12 g/mol. IUPAC name: 3,4,5-trideuteriofuran-2-carboxamide. InChIKey: TVFIYRKPCACCNL-CBYSEHNBSA-N.
| Molecular formula | C5H5NO2 |
|---|---|
| Molecular weight | 114.12 g/mol |
| IUPAC name | 3,4,5-trideuteriofuran-2-carboxamide |
| InChIKey | TVFIYRKPCACCNL-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(OC(=C1[2H])C(=O)N)[2H] |
Computed by PubChem (NCBI)