Products 1219799-38-8
CAS 1219799-38-8 appears in our catalog under these names: n-Butyl Acetate-d12, 98 atom % D, min 98% Chemical Purity, N–BUTYL ACETATE–D12. Offered by: CDN, GLPBio. Available pack sizes: 0,5g, 0,25g, 10mg.
1,1,2,2,3,3,4,4,4-nonadeuteriobutyl 2,2,2-trideuterioacetate (CAS 1219799-38-8) is a chemical compound with the molecular formula C6H12O2 and a molecular weight of 128.23 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,4-nonadeuteriobutyl 2,2,2-trideuterioacetate. InChIKey: DKPFZGUDAPQIHT-HYVJACIRSA-N.
| Molecular formula | C6H12O2 |
|---|---|
| Molecular weight | 128.23 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,4-nonadeuteriobutyl 2,2,2-trideuterioacetate |
| InChIKey | DKPFZGUDAPQIHT-HYVJACIRSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)OC([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)