CAS 1219799-39-9 appears in our catalog under these names: 4-Hydroxypiperidine-d9, 4-Hydroxypiperidine-2,2,3,3,4,5,5,6,6-d9, 98 atom % D, min 98% Chemical Purity, Piperidin–4–ol–d9, Piperidin-4-ol-d9. Offered by: TRC, CDN, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, 0,25g, 0,1g, 10mg, 25mg, 5mg.
2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-ol (CAS 1219799-39-9) is a chemical compound with the molecular formula C5H11NO and a molecular weight of 110.20 g/mol. IUPAC name: 2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-ol. InChIKey: HDOWRFHMPULYOA-UHUJFCCWSA-N.
| Molecular formula | C5H11NO |
|---|---|
| Molecular weight | 110.20 g/mol |
| IUPAC name | 2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-ol |
| InChIKey | HDOWRFHMPULYOA-UHUJFCCWSA-N |
| SMILES | [2H]C1(C(NC(C(C1([2H])O)([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)