CAS 1219799-40-2 appears in our catalog under these names: Isonicotinamide-d4, >95% (HPLC), Isonicotinamide-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity, Isonicotinamide-d4, 99.91%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,25g, 0,1g, 10 mg, 25 mg, 5 mg, 50 mg.
2,3,5,6-tetradeuteriopyridine-4-carboxamide (CAS 1219799-40-2) is a chemical compound with the molecular formula C6H6N2O and a molecular weight of 126.15 g/mol. IUPAC name: 2,3,5,6-tetradeuteriopyridine-4-carboxamide. InChIKey: VFQXVTODMYMSMJ-RHQRLBAQSA-N.
| Molecular formula | C6H6N2O |
|---|---|
| Molecular weight | 126.15 g/mol |
| IUPAC name | 2,3,5,6-tetradeuteriopyridine-4-carboxamide |
| InChIKey | VFQXVTODMYMSMJ-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(N=C(C(=C1C(=O)N)[2H])[2H])[2H] |
Computed by PubChem (NCBI)