CAS 1219802-14-8 appears in our catalog under these names: 3-Aminobenzotrifluoride-D4, 3-(Trifluoromethyl)aniline-2,4,5,6-d4, 98 atom % D, min 98% Chemical Purity, 3–Aminobenzotrifluoride–D4. Offered by: TRC, CDN, GLPBio. Available pack sizes: 10mg, 0,25g, 0,1g, 5mg.
2,3,4,6-tetradeuterio-5-(trifluoromethyl)aniline (CAS 1219802-14-8) is a chemical compound with the molecular formula C7H6F3N and a molecular weight of 165.15 g/mol. IUPAC name: 2,3,4,6-tetradeuterio-5-(trifluoromethyl)aniline. InChIKey: VIUDTWATMPPKEL-RHQRLBAQSA-N.
| Molecular formula | C7H6F3N |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2,3,4,6-tetradeuterio-5-(trifluoromethyl)aniline |
| InChIKey | VIUDTWATMPPKEL-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])N)[2H])C(F)(F)F)[2H] |
Computed by PubChem (NCBI)