CAS 1219802-16-0 appears in our catalog under these names: Sodium n-Octyl-d17 Sulfate, 98 atom % D, min 98% Chemical Purity, Sodium octyl sulfate(Reagent for Ion-Pair Chromatography,99%)-d17. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 25 mg, 5 mg, 50 mg, 10 mg.
Sodium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl sulfate (CAS 1219802-16-0) is a chemical compound with the molecular formula C8H17NaO4S and a molecular weight of 249.38 g/mol. IUPAC name: sodium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl sulfate. InChIKey: WFRKJMRGXGWHBM-DWZFKBFMSA-M.
| Molecular formula | C8H17NaO4S |
|---|---|
| Molecular weight | 249.38 g/mol |
| IUPAC name | sodium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl sulfate |
| InChIKey | WFRKJMRGXGWHBM-DWZFKBFMSA-M |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)