Products 1219802-17-1

CAS 1219802-17-1 is the registry number for 3-Chloropropionic-2,2,3,3-d4 Acid, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.

Structural formula: {0} (CAS {1})

3-chloro-2,2,3,3-tetradeuteriopropanoic acid (CAS 1219802-17-1) is a chemical compound with the molecular formula C3H5ClO2 and a molecular weight of 112.55 g/mol. IUPAC name: 3-chloro-2,2,3,3-tetradeuteriopropanoic acid. InChIKey: QEYMMOKECZBKAC-LNLMKGTHSA-N.

Identity
Molecular formulaC3H5ClO2
Molecular weight112.55 g/mol
IUPAC name3-chloro-2,2,3,3-tetradeuteriopropanoic acid
InChIKeyQEYMMOKECZBKAC-LNLMKGTHSA-N
SMILES[2H]C([2H])(C(=O)O)C([2H])([2H])Cl

Computed by PubChem (NCBI)