CAS 1219802-17-1 is the registry number for 3-Chloropropionic-2,2,3,3-d4 Acid, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.
3-chloro-2,2,3,3-tetradeuteriopropanoic acid (CAS 1219802-17-1) is a chemical compound with the molecular formula C3H5ClO2 and a molecular weight of 112.55 g/mol. IUPAC name: 3-chloro-2,2,3,3-tetradeuteriopropanoic acid. InChIKey: QEYMMOKECZBKAC-LNLMKGTHSA-N.
| Molecular formula | C3H5ClO2 |
|---|---|
| Molecular weight | 112.55 g/mol |
| IUPAC name | 3-chloro-2,2,3,3-tetradeuteriopropanoic acid |
| InChIKey | QEYMMOKECZBKAC-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])Cl |
Computed by PubChem (NCBI)