Products 1219802-19-3
CAS 1219802-19-3 appears in our catalog under these names: N,N-Dimethyl-d3-chloroacetamide (N-methyl-d3), 99 atom % D, min 98% Chemical Purity, 2-Chloro-N,N-dimethylacetamide-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
2-chloro-N-methyl-N-(trideuteriomethyl)acetamide (CAS 1219802-19-3) is a chemical compound with the molecular formula C4H8ClNO and a molecular weight of 124.58 g/mol. IUPAC name: 2-chloro-N-methyl-N-(trideuteriomethyl)acetamide. InChIKey: XBPPLECAZBTMMK-FIBGUPNXSA-N.
| Molecular formula | C4H8ClNO |
|---|---|
| Molecular weight | 124.58 g/mol |
| IUPAC name | 2-chloro-N-methyl-N-(trideuteriomethyl)acetamide |
| InChIKey | XBPPLECAZBTMMK-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N(C)C(=O)CCl |
Computed by PubChem (NCBI)