CAS 1219802-58-0 appears in our catalog under these names: 4-Chlorothiobenzamide-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity, 4-Chlorothiobenzamide-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
4-chloro-2,3,5,6-tetradeuteriobenzenecarbothioamide (CAS 1219802-58-0) is a chemical compound with the molecular formula C7H6ClNS and a molecular weight of 175.67 g/mol. IUPAC name: 4-chloro-2,3,5,6-tetradeuteriobenzenecarbothioamide. InChIKey: OKPUICCJRDBRJT-RHQRLBAQSA-N.
| Molecular formula | C7H6ClNS |
|---|---|
| Molecular weight | 175.67 g/mol |
| IUPAC name | 4-chloro-2,3,5,6-tetradeuteriobenzenecarbothioamide |
| InChIKey | OKPUICCJRDBRJT-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=S)N)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)