CAS 1219802-64-8 appears in our catalog under these names: Iodoacetamide-d4, 99 atom % D, min 98% Chemical Purity, 2–Iodoacetamide–d4, 2-Iodoacetamide-d4, 99.90%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1mg, 10mg, 5mg, 1 mg, 5 mg, 10 mg.
N,N,2,2-tetradeuterio-2-iodoacetamide (CAS 1219802-64-8) is a chemical compound with the molecular formula C2H4INO and a molecular weight of 188.99 g/mol. IUPAC name: N,N,2,2-tetradeuterio-2-iodoacetamide. InChIKey: PGLTVOMIXTUURA-BGOGGDMHSA-N.
| Molecular formula | C2H4INO |
|---|---|
| Molecular weight | 188.99 g/mol |
| IUPAC name | N,N,2,2-tetradeuterio-2-iodoacetamide |
| InChIKey | PGLTVOMIXTUURA-BGOGGDMHSA-N |
| SMILES | [2H]C([2H])(C(=O)N([2H])[2H])I |
Computed by PubChem (NCBI)