CAS 1219802-71-7 appears in our catalog under these names: N,N-Dimethyl-1,3-propylenediamine-d6, >95% (GC), 3-(Dimethyl-d6-amino)-1-propylamine, 99 atom % D, min 98% Chemical Purity, 3-1-Propylamine. Offered by: TRC, CDN, Biosynth. Available pack sizes: 50mg, 5mg, 0,25g, 0,1g, 25mg.
N',N'-bis(trideuteriomethyl)propane-1,3-diamine (CAS 1219802-71-7) is a chemical compound with the molecular formula C5H14N2 and a molecular weight of 108.22 g/mol. IUPAC name: N',N'-bis(trideuteriomethyl)propane-1,3-diamine. InChIKey: IUNMPGNGSSIWFP-WFGJKAKNSA-N.
| Molecular formula | C5H14N2 |
|---|---|
| Molecular weight | 108.22 g/mol |
| IUPAC name | N',N'-bis(trideuteriomethyl)propane-1,3-diamine |
| InChIKey | IUNMPGNGSSIWFP-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(CCCN)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)