Products 1219802-72-8
CAS 1219802-72-8 appears in our catalog under these names: n-Dodecyl-d25-amine, n-Dodecyl-d25-amine, 98 atom % D, min 98% Chemical Purity, Dodecylamine-d25. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 500 μg, 5 mg, 1 mg.
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosadeuteriododecan-1-amine (CAS 1219802-72-8) is a chemical compound with the molecular formula C12H27N and a molecular weight of 210.50 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosadeuteriododecan-1-amine. InChIKey: JRBPAEWTRLWTQC-VVZIYBSUSA-N.
| Molecular formula | C12H27N |
|---|---|
| Molecular weight | 210.50 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosadeuteriododecan-1-amine |
| InChIKey | JRBPAEWTRLWTQC-VVZIYBSUSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N |
Computed by PubChem (NCBI)
Synonyms:
Dodecylamine-25d