CAS 1219802-76-2 appears in our catalog under these names: 4'-Aminoacetanilide-2',3',5',6'-d4, 4'-Aminoacetanilide-2',3',5',6'-d4, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 2,5mg, 25mg, 5mg, 0,25g, 0,1g.
N-(4-amino-2,3,5,6-tetradeuteriophenyl)acetamide (CAS 1219802-76-2) is a chemical compound with the molecular formula C8H10N2O and a molecular weight of 154.20 g/mol. IUPAC name: N-(4-amino-2,3,5,6-tetradeuteriophenyl)acetamide. InChIKey: CHMBIJAOCISYEW-QFFDRWTDSA-N.
| Molecular formula | C8H10N2O |
|---|---|
| Molecular weight | 154.20 g/mol |
| IUPAC name | N-(4-amino-2,3,5,6-tetradeuteriophenyl)acetamide |
| InChIKey | CHMBIJAOCISYEW-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])NC(=O)C)[2H] |
Computed by PubChem (NCBI)