Products 1219802-96-6
CAS 1219802-96-6 appears in our catalog under these names: 4-Ethylaniline-d11, 98 atom % D, min 98% Chemical Purity, 4-Ethylaniline-d11. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
N,N,2,3,5,6-hexadeuterio-4-(1,1,2,2,2-pentadeuterioethyl)aniline (CAS 1219802-96-6) is a chemical compound with the molecular formula C8H11N and a molecular weight of 132.25 g/mol. IUPAC name: N,N,2,3,5,6-hexadeuterio-4-(1,1,2,2,2-pentadeuterioethyl)aniline. InChIKey: HRXZRAXKKNUKRF-NPIAGUBKSA-N.
| Molecular formula | C8H11N |
|---|---|
| Molecular weight | 132.25 g/mol |
| IUPAC name | N,N,2,3,5,6-hexadeuterio-4-(1,1,2,2,2-pentadeuterioethyl)aniline |
| InChIKey | HRXZRAXKKNUKRF-NPIAGUBKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])C([2H])([2H])[2H])[2H])[2H])N([2H])[2H])[2H] |
Computed by PubChem (NCBI)