CAS 1219803-02-7 appears in our catalog under these names: Glyburide-d3 (methoxy-d3), >95% (HPLC), Glyburide-d3 (methoxy-d3), 99 atom % D, min 98% Chemical Purity, Glyburide–d3, Glyburide-d3, 99.64%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 0,01g, 0,005g, 1mg, 10mg, 5mg.
5-chloro-N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2-(trideuteriomethoxy)benzamide (CAS 1219803-02-7) is a chemical compound with the molecular formula C23H28ClN3O5S and a molecular weight of 497.0 g/mol. IUPAC name: 5-chloro-N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2-(trideuteriomethoxy)benzamide. InChIKey: ZNNLBTZKUZBEKO-FIBGUPNXSA-N.
| Molecular formula | C23H28ClN3O5S |
|---|---|
| Molecular weight | 497.0 g/mol |
| IUPAC name | 5-chloro-N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2-(trideuteriomethoxy)benzamide |
| InChIKey | ZNNLBTZKUZBEKO-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)Cl)C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)NC(=O)NC3CCCCC3 |
Computed by PubChem (NCBI)