Products 1219803-10-7
CAS 1219803-10-7 appears in our catalog under these names: 2-(N-Benzyl-N-methyl)aminoethanol-1,1,2,2-d4, 99 atom % D, min 98% Chemical Purity, 2-(Benzyl(methyl)amino)ethanol-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
2-[benzyl(methyl)amino]-1,1,2,2-tetradeuterioethanol (CAS 1219803-10-7) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 169.26 g/mol. IUPAC name: 2-[benzyl(methyl)amino]-1,1,2,2-tetradeuterioethanol. InChIKey: WOUANPHGFPAJCA-OSEHSPPNSA-N.
| Molecular formula | C10H15NO |
|---|---|
| Molecular weight | 169.26 g/mol |
| IUPAC name | 2-[benzyl(methyl)amino]-1,1,2,2-tetradeuterioethanol |
| InChIKey | WOUANPHGFPAJCA-OSEHSPPNSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)N(C)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)