Products 1219803-27-6
CAS 1219803-27-6 appears in our catalog under these names: Methyliminodiacetic-d4 Acid, 98 atom % D, min 97% Chemical Purity, N-Methyliminodiacetic acid-d4, 98.9%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 25 mg, 10 mg, 5 mg.
2-[[carboxy(dideuterio)methyl]-methylamino]-2,2-dideuterioacetic acid (CAS 1219803-27-6) is a chemical compound with the molecular formula C5H9NO4 and a molecular weight of 151.15 g/mol. IUPAC name: 2-[[carboxy(dideuterio)methyl]-methylamino]-2,2-dideuterioacetic acid. InChIKey: XWSGEVNYFYKXCP-RRVWJQJTSA-N.
| Molecular formula | C5H9NO4 |
|---|---|
| Molecular weight | 151.15 g/mol |
| IUPAC name | 2-[[carboxy(dideuterio)methyl]-methylamino]-2,2-dideuterioacetic acid |
| InChIKey | XWSGEVNYFYKXCP-RRVWJQJTSA-N |
| SMILES | [2H]C([2H])(C(=O)O)N(C)C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)