Products 1219803-31-2
CAS 1219803-31-2 appears in our catalog under these names: 1-Piperidine-d10-carbonyl Chloride, 98 atom % D, min 98% Chemical Purity, 1-(Chlorocarbonyl)piperidine-d10, 98.2%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 1 mg, 5 mg, 25 mg, 50 mg, 10 mg.
2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidine-1-carbonyl chloride (CAS 1219803-31-2) is a chemical compound with the molecular formula C6H10ClNO and a molecular weight of 157.66 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidine-1-carbonyl chloride. InChIKey: BIFDXOOJPDHKJH-YXALHFAPSA-N.
| Molecular formula | C6H10ClNO |
|---|---|
| Molecular weight | 157.66 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidine-1-carbonyl chloride |
| InChIKey | BIFDXOOJPDHKJH-YXALHFAPSA-N |
| SMILES | [2H]C1(C(C(N(C(C1([2H])[2H])([2H])[2H])C(=O)Cl)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)