Products 1219803-40-3

CAS 1219803-40-3 is the registry number for 1,3-Diethylbenzene-d14, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

1,2,3,5-tetradeuterio-4,6-bis(1,1,2,2,2-pentadeuterioethyl)benzene (CAS 1219803-40-3) is a chemical compound with the molecular formula C10H14 and a molecular weight of 148.30 g/mol. IUPAC name: 1,2,3,5-tetradeuterio-4,6-bis(1,1,2,2,2-pentadeuterioethyl)benzene. InChIKey: AFZZYIJIWUTJFO-NFUPRKAOSA-N.

Identity
Molecular formulaC10H14
Molecular weight148.30 g/mol
IUPAC name1,2,3,5-tetradeuterio-4,6-bis(1,1,2,2,2-pentadeuterioethyl)benzene
InChIKeyAFZZYIJIWUTJFO-NFUPRKAOSA-N
SMILES[2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])C([2H])([2H])[2H])[2H])C([2H])([2H])C([2H])([2H])[2H])[2H]

Computed by PubChem (NCBI)