Products 1219803-45-8
CAS 1219803-45-8 appears in our catalog under these names: Prometon-d14 (di-iso-propyl-d14), 98 atom % D, min 98% Chemical Purity, Prometon-d14, 98.4%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1 mg.
2-N,4-N-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-6-methoxy-1,3,5-triazine-2,4-diamine (CAS 1219803-45-8) is a chemical compound with the molecular formula C10H19N5O and a molecular weight of 239.38 g/mol. IUPAC name: 2-N,4-N-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-6-methoxy-1,3,5-triazine-2,4-diamine. InChIKey: ISEUFVQQFVOBCY-MFVRGKIVSA-N.
| Molecular formula | C10H19N5O |
|---|---|
| Molecular weight | 239.38 g/mol |
| IUPAC name | 2-N,4-N-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-6-methoxy-1,3,5-triazine-2,4-diamine |
| InChIKey | ISEUFVQQFVOBCY-MFVRGKIVSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NC1=NC(=NC(=N1)OC)NC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)