Products 1219803-46-9
CAS 1219803-46-9 is the registry number for 3-Methylbutyryl-d9 Chloride, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
2,2,3,4,4,4-hexadeuterio-3-(trideuteriomethyl)butanoyl chloride (CAS 1219803-46-9) is a chemical compound with the molecular formula C5H9ClO and a molecular weight of 129.63 g/mol. IUPAC name: 2,2,3,4,4,4-hexadeuterio-3-(trideuteriomethyl)butanoyl chloride. InChIKey: ISULZYQDGYXDFW-CBZKUFJVSA-N.
| Molecular formula | C5H9ClO |
|---|---|
| Molecular weight | 129.63 g/mol |
| IUPAC name | 2,2,3,4,4,4-hexadeuterio-3-(trideuteriomethyl)butanoyl chloride |
| InChIKey | ISULZYQDGYXDFW-CBZKUFJVSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])C(=O)Cl |
Computed by PubChem (NCBI)