Products 1219803-54-9
CAS 1219803-54-9 appears in our catalog under these names: N,N,N'-Trimethyl-d6-1,3-propanediamine (N,N-dimethyl-d6), 98 atom % D, min 96% Chemical Purity, N,N,N-Trimethyl-1,3-propanediamine-d6. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
N-methyl-N',N'-bis(trideuteriomethyl)propane-1,3-diamine (CAS 1219803-54-9) is a chemical compound with the molecular formula C6H16N2 and a molecular weight of 122.24 g/mol. IUPAC name: N-methyl-N',N'-bis(trideuteriomethyl)propane-1,3-diamine. InChIKey: SORARJZLMNRBAQ-XERRXZQWSA-N.
| Molecular formula | C6H16N2 |
|---|---|
| Molecular weight | 122.24 g/mol |
| IUPAC name | N-methyl-N',N'-bis(trideuteriomethyl)propane-1,3-diamine |
| InChIKey | SORARJZLMNRBAQ-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])N(CCCNC)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)