CAS 1219803-60-7 appears in our catalog under these names: 4-Aminopiperidine-3,3,4,5,5-d5, 98 atom % D, min 98% Chemical Purity, Piperidin-4-amine-d5. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10 mg.
3,3,4,5,5-pentadeuteriopiperidin-4-amine (CAS 1219803-60-7) is a chemical compound with the molecular formula C5H12N2 and a molecular weight of 105.19 g/mol. IUPAC name: 3,3,4,5,5-pentadeuteriopiperidin-4-amine. InChIKey: BCIIMDOZSUCSEN-QJWYSIDNSA-N.
| Molecular formula | C5H12N2 |
|---|---|
| Molecular weight | 105.19 g/mol |
| IUPAC name | 3,3,4,5,5-pentadeuteriopiperidin-4-amine |
| InChIKey | BCIIMDOZSUCSEN-QJWYSIDNSA-N |
| SMILES | [2H]C1(CNCC(C1([2H])N)([2H])[2H])[2H] |
Computed by PubChem (NCBI)