Products 1219803-64-1
CAS 1219803-64-1 is the registry number for 1,4-Diethylbenzene-d14, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
1,2,4,5-tetradeuterio-3,6-bis(1,1,2,2,2-pentadeuterioethyl)benzene (CAS 1219803-64-1) is a chemical compound with the molecular formula C10H14 and a molecular weight of 148.30 g/mol. IUPAC name: 1,2,4,5-tetradeuterio-3,6-bis(1,1,2,2,2-pentadeuterioethyl)benzene. InChIKey: DSNHSQKRULAAEI-NFUPRKAOSA-N.
| Molecular formula | C10H14 |
|---|---|
| Molecular weight | 148.30 g/mol |
| IUPAC name | 1,2,4,5-tetradeuterio-3,6-bis(1,1,2,2,2-pentadeuterioethyl)benzene |
| InChIKey | DSNHSQKRULAAEI-NFUPRKAOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])C([2H])([2H])[2H])[2H])[2H])C([2H])([2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)