CAS 1219803-65-2 appears in our catalog under these names: 3–Amino–2–methylpropanoic acid–d3, 3-Amino-2-methylpropanoic acid-d3, (±)-3-Amino-iso-butyric-2,3,3-d3 Acid, >95% (HPLC), (±)-3-Amino-iso-butyric-2,3,3-d3 Acid, 98 atom % D, min 98% Chemical Purity. Offered by: GLPBio, MedChemExpress, TRC, CDN. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg, 50 mg, 10 mg, 25 mg, 10mg.
3-amino-2,3,3-trideuterio-2-methylpropanoic acid (CAS 1219803-65-2) is a chemical compound with the molecular formula C4H9NO2 and a molecular weight of 106.14 g/mol. IUPAC name: 3-amino-2,3,3-trideuterio-2-methylpropanoic acid. InChIKey: QCHPKSFMDHPSNR-UHVFUKFASA-N.
| Molecular formula | C4H9NO2 |
|---|---|
| Molecular weight | 106.14 g/mol |
| IUPAC name | 3-amino-2,3,3-trideuterio-2-methylpropanoic acid |
| InChIKey | QCHPKSFMDHPSNR-UHVFUKFASA-N |
| SMILES | [2H]C([2H])(C([2H])(C)C(=O)O)N |
Computed by PubChem (NCBI)