Products 1219803-71-0
CAS 1219803-71-0 appears in our catalog under these names: 2-Oxopiperazine-3,3,5,5,6,6-d6, 98 atom % D, min 98% Chemical Purity, 2-Oxopiperazine-3,3,5,5,6,6-d6, Piperazin-2-one-d6, 99.3%. Offered by: CDN, Biosynth, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 50mg, 1 mg, 50 mg, 5 mg, 10 mg, 25 mg.
3,3,5,5,6,6-hexadeuteriopiperazin-2-one (CAS 1219803-71-0) is a chemical compound with the molecular formula C4H8N2O and a molecular weight of 106.16 g/mol. IUPAC name: 3,3,5,5,6,6-hexadeuteriopiperazin-2-one. InChIKey: IWELDVXSEVIIGI-NMFSSPJFSA-N.
| Molecular formula | C4H8N2O |
|---|---|
| Molecular weight | 106.16 g/mol |
| IUPAC name | 3,3,5,5,6,6-hexadeuteriopiperazin-2-one |
| InChIKey | IWELDVXSEVIIGI-NMFSSPJFSA-N |
| SMILES | [2H]C1(C(=O)NC(C(N1)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)