Products 1219803-74-3
CAS 1219803-74-3 appears in our catalog under these names: Hexanal-d12, >95% (GC), Hexanal-d12, 98 atom % D, min 96% Chemical Purity, D12-Hexanal. Offered by: TRC, CDN, HPC Standards. Available pack sizes: 100mg, 10mg, 0,25g, 0,1g, 1x10mg.
1,2,2,3,3,4,4,5,5,6,6,6-dodecadeuteriohexan-1-one (CAS 1219803-74-3) is a chemical compound with the molecular formula C6H12O and a molecular weight of 112.23 g/mol. IUPAC name: 1,2,2,3,3,4,4,5,5,6,6,6-dodecadeuteriohexan-1-one. InChIKey: JARKCYVAAOWBJS-PSDCQUMKSA-N.
| Molecular formula | C6H12O |
|---|---|
| Molecular weight | 112.23 g/mol |
| IUPAC name | 1,2,2,3,3,4,4,5,5,6,6,6-dodecadeuteriohexan-1-one |
| InChIKey | JARKCYVAAOWBJS-PSDCQUMKSA-N |
| SMILES | [2H]C(=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)