CAS 1219803-78-7 appears in our catalog under these names: 9-Anthracene-d9-carboxylic Acid, 98 atom % D, min 98% Chemical Purity, Anthracene–9–carboxylic acid–d9, Anthracene-9-carboxylic acid-d9, 98.94%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1mg, 10mg, 5mg, 1 mg, 10 mg, 5 mg.
1,2,3,4,5,6,7,8,10-nonadeuterioanthracene-9-carboxylic acid (CAS 1219803-78-7) is a chemical compound with the molecular formula C15H10O2 and a molecular weight of 231.29 g/mol. IUPAC name: 1,2,3,4,5,6,7,8,10-nonadeuterioanthracene-9-carboxylic acid. InChIKey: XGWFJBFNAQHLEF-LOIXRAQWSA-N.
| Molecular formula | C15H10O2 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 1,2,3,4,5,6,7,8,10-nonadeuterioanthracene-9-carboxylic acid |
| InChIKey | XGWFJBFNAQHLEF-LOIXRAQWSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C3C(=C(C(=C(C3=C2C(=O)O)[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)