Products 1219803-81-2
CAS 1219803-81-2 appears in our catalog under these names: beta-Iminodi(propionic-2,2,3,3-d4) Acid, 98 atom % D, min 98% Chemical Purity, 3,3'-Azanediyldipropionic acid-d8. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
3-[(2-carboxy-1,1,2,2-tetradeuterioethyl)amino]-2,2,3,3-tetradeuteriopropanoic acid (CAS 1219803-81-2) is a chemical compound with the molecular formula C6H11NO4 and a molecular weight of 169.20 g/mol. IUPAC name: 3-[(2-carboxy-1,1,2,2-tetradeuterioethyl)amino]-2,2,3,3-tetradeuteriopropanoic acid. InChIKey: TXPKUUXHNFRBPS-SVYQBANQSA-N.
| Molecular formula | C6H11NO4 |
|---|---|
| Molecular weight | 169.20 g/mol |
| IUPAC name | 3-[(2-carboxy-1,1,2,2-tetradeuterioethyl)amino]-2,2,3,3-tetradeuteriopropanoic acid |
| InChIKey | TXPKUUXHNFRBPS-SVYQBANQSA-N |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])NC([2H])([2H])C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)