Products 1219803-82-3
CAS 1219803-82-3 appears in our catalog under these names: Methyl 3-bromopropanoate-d4, Methyl 3-Bromopropionate-2,2,3,3-d4, 98 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, CDN. Available pack sizes: 1 mg, 0,25g, 0,1g.
Methyl 3-bromo-2,2,3,3-tetradeuteriopropanoate (CAS 1219803-82-3) is a chemical compound with the molecular formula C4H7BrO2 and a molecular weight of 171.03 g/mol. IUPAC name: methyl 3-bromo-2,2,3,3-tetradeuteriopropanoate. InChIKey: KQEVIFKPZOGBMZ-RRVWJQJTSA-N.
| Molecular formula | C4H7BrO2 |
|---|---|
| Molecular weight | 171.03 g/mol |
| IUPAC name | methyl 3-bromo-2,2,3,3-tetradeuteriopropanoate |
| InChIKey | KQEVIFKPZOGBMZ-RRVWJQJTSA-N |
| SMILES | [2H]C([2H])(C(=O)OC)C([2H])([2H])Br |
Computed by PubChem (NCBI)