Products 1219803-83-4
CAS 1219803-83-4 appears in our catalog under these names: 1-Bromo-3,5-dichlorobenzene-d3, 98 atom % D, min 98% Chemical Purity, 1-Bromo-3,5-dichlorobenzene-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 0,5g, 1 mg.
1-bromo-3,5-dichloro-2,4,6-trideuteriobenzene (CAS 1219803-83-4) is a chemical compound with the molecular formula C6H3BrCl2 and a molecular weight of 228.91 g/mol. IUPAC name: 1-bromo-3,5-dichloro-2,4,6-trideuteriobenzene. InChIKey: DZHFFMWJXJBBRG-CBYSEHNBSA-N.
| Molecular formula | C6H3BrCl2 |
|---|---|
| Molecular weight | 228.91 g/mol |
| IUPAC name | 1-bromo-3,5-dichloro-2,4,6-trideuteriobenzene |
| InChIKey | DZHFFMWJXJBBRG-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Cl)[2H])Br)[2H])Cl |
Computed by PubChem (NCBI)