Products 1219803-88-9
CAS 1219803-88-9 appears in our catalog under these names: N,N-Diisopropylamine-d14 Hydrochloride, >95% (HPLC), Di-iso-propyl-d14-amine HCl, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 100mg, 1g, 0,25g, 0,1g.
1,1,1,2,3,3,3-heptadeuterio-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)propan-2-amine;hydrochloride (CAS 1219803-88-9) is a chemical compound with the molecular formula C6H16ClN and a molecular weight of 151.74 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptadeuterio-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)propan-2-amine;hydrochloride. InChIKey: URAZVWXGWMBUGJ-VSHQPLEZSA-N.
| Molecular formula | C6H16ClN |
|---|---|
| Molecular weight | 151.74 g/mol |
| IUPAC name | 1,1,1,2,3,3,3-heptadeuterio-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)propan-2-amine;hydrochloride |
| InChIKey | URAZVWXGWMBUGJ-VSHQPLEZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)