CAS 1219803-90-3 appears in our catalog under these names: 1,5-Dibromopentane-1,1,5,5-d4, 1,5-Dibromopentane-1,1,5,5-d4, 99 atom % D, min 98% Chemical Purity, 1,5-Dibromopentane-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 5mg, 0,25g, 0,1g, 25 mg, 2.5 mg, 5 mg.
1,5-dibromo-1,1,5,5-tetradeuteriopentane (CAS 1219803-90-3) is a chemical compound with the molecular formula C5H10Br2 and a molecular weight of 233.97 g/mol. IUPAC name: 1,5-dibromo-1,1,5,5-tetradeuteriopentane. InChIKey: IBODDUNKEPPBKW-CQOLUAMGSA-N.
| Molecular formula | C5H10Br2 |
|---|---|
| Molecular weight | 233.97 g/mol |
| IUPAC name | 1,5-dibromo-1,1,5,5-tetradeuteriopentane |
| InChIKey | IBODDUNKEPPBKW-CQOLUAMGSA-N |
| SMILES | [2H]C([2H])(CCCC([2H])([2H])Br)Br |
Computed by PubChem (NCBI)