Products 1219803-98-1
CAS 1219803-98-1 appears in our catalog under these names: Heptanoic-6,6,7,7,7-d5 Acid, Heptanoic-6,6,7,7,7-d5 Acid, 99 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 10mg, 50mg, 5mg, 0,5g, 0,25g.
6,6,7,7,7-pentadeuterioheptanoic acid (CAS 1219803-98-1) is a chemical compound with the molecular formula C7H14O2 and a molecular weight of 135.22 g/mol. IUPAC name: 6,6,7,7,7-pentadeuterioheptanoic acid. InChIKey: MNWFXJYAOYHMED-ZBJDZAJPSA-N.
| Molecular formula | C7H14O2 |
|---|---|
| Molecular weight | 135.22 g/mol |
| IUPAC name | 6,6,7,7,7-pentadeuterioheptanoic acid |
| InChIKey | MNWFXJYAOYHMED-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CCCCC(=O)O |
Computed by PubChem (NCBI)