Products 1219804-01-9
CAS 1219804-01-9 is the registry number for p-Tolunitrile-d7, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzonitrile (CAS 1219804-01-9) is a chemical compound with the molecular formula C8H7N and a molecular weight of 124.19 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzonitrile. InChIKey: VCZNNAKNUVJVGX-AAYPNNLASA-N.
| Molecular formula | C8H7N |
|---|---|
| Molecular weight | 124.19 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzonitrile |
| InChIKey | VCZNNAKNUVJVGX-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C#N)[2H])[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)