Products 1219804-04-2
CAS 1219804-04-2 appears in our catalog under these names: 2,2-Dimethylbutyric-d11 Acid, 98 atom % D, min 98% Chemical Purity, 2,2–Dimethylbutanoic acid–d11, 2,2-Dimethylbutanoic acid-d11, 99.09%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 1g, 0,5g, 10mg, 100mg, 25mg, 5mg, 50mg, 100 mg.
3,3,4,4,4-pentadeuterio-2,2-bis(trideuteriomethyl)butanoic acid (CAS 1219804-04-2) is a chemical compound with the molecular formula C6H12O2 and a molecular weight of 127.23 g/mol. IUPAC name: 3,3,4,4,4-pentadeuterio-2,2-bis(trideuteriomethyl)butanoic acid. InChIKey: VUAXHMVRKOTJKP-BIQBMNTRSA-N.
| Molecular formula | C6H12O2 |
|---|---|
| Molecular weight | 127.23 g/mol |
| IUPAC name | 3,3,4,4,4-pentadeuterio-2,2-bis(trideuteriomethyl)butanoic acid |
| InChIKey | VUAXHMVRKOTJKP-BIQBMNTRSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(C(=O)O)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)