Products 1219804-13-3
CAS 1219804-13-3 appears in our catalog under these names: 4-Fluorobenzyl-d6 Chloride, 98 atom % D, min 98% Chemical Purity, 4-Fluorobenzyl chloride-d6. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
1-[chloro(dideuterio)methyl]-2,3,5,6-tetradeuterio-4-fluorobenzene (CAS 1219804-13-3) is a chemical compound with the molecular formula C7H6ClF and a molecular weight of 150.61 g/mol. IUPAC name: 1-[chloro(dideuterio)methyl]-2,3,5,6-tetradeuterio-4-fluorobenzene. InChIKey: IZXWCDITFDNEBY-NVSFMWKBSA-N.
| Molecular formula | C7H6ClF |
|---|---|
| Molecular weight | 150.61 g/mol |
| IUPAC name | 1-[chloro(dideuterio)methyl]-2,3,5,6-tetradeuterio-4-fluorobenzene |
| InChIKey | IZXWCDITFDNEBY-NVSFMWKBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])Cl)[2H])[2H])F)[2H] |
Computed by PubChem (NCBI)