CAS 1219804-19-9 appears in our catalog under these names: Cyromazine-d4, >95% (HPLC), Cyromazine D4 (cyclopropyl-2,2,3,3 D4), Cyromazine-d4 (cyclopropyl-2,2,3,3-d4), 99 atom % D, min 98% Chemical Purity, Cyromazine–d4, CYROMAZINE-(CYCLOPROPYL-2,2,3,3-D4). Offered by: TRC, Dr. Ehrenstorfer, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 10mg, 1mg, 0,01g, 0,005g, 5MG, 1 mg, 1x10mg, 1x1ml.
2-N-(2,2,3,3-tetradeuteriocyclopropyl)-1,3,5-triazine-2,4,6-triamine (CAS 1219804-19-9) is a chemical compound with the molecular formula C6H10N6 and a molecular weight of 170.21 g/mol. IUPAC name: 2-N-(2,2,3,3-tetradeuteriocyclopropyl)-1,3,5-triazine-2,4,6-triamine. InChIKey: LVQDKIWDGQRHTE-LNLMKGTHSA-N.
| Molecular formula | C6H10N6 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 2-N-(2,2,3,3-tetradeuteriocyclopropyl)-1,3,5-triazine-2,4,6-triamine |
| InChIKey | LVQDKIWDGQRHTE-LNLMKGTHSA-N |
| SMILES | [2H]C1(C(C1([2H])[2H])NC2=NC(=NC(=N2)N)N)[2H] |
Computed by PubChem (NCBI)