CAS 1219804-33-7 is the registry number for 4-Chloro-alpha,alpha,alpha-trifluorotoluene-d4, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
1-chloro-2,3,5,6-tetradeuterio-4-(trifluoromethyl)benzene (CAS 1219804-33-7) is a chemical compound with the molecular formula C7H4ClF3 and a molecular weight of 184.58 g/mol. IUPAC name: 1-chloro-2,3,5,6-tetradeuterio-4-(trifluoromethyl)benzene. InChIKey: QULYNCCPRWKEMF-RHQRLBAQSA-N.
| Molecular formula | C7H4ClF3 |
|---|---|
| Molecular weight | 184.58 g/mol |
| IUPAC name | 1-chloro-2,3,5,6-tetradeuterio-4-(trifluoromethyl)benzene |
| InChIKey | QULYNCCPRWKEMF-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(F)(F)F)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)