Products 1219804-42-8
CAS 1219804-42-8 appears in our catalog under these names: 1,5-Pentane-d10-diol, 1,5-Pentane-d10-diol, 98 atom % D, min 98% Chemical Purity, 1,5-Dihydroxypentane-d10. Offered by: TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 5mg, 0,25g, 0,1g, 100mg, 50mg, 5 mg.
1,1,2,2,3,3,4,4,5,5-decadeuteriopentane-1,5-diol (CAS 1219804-42-8) is a chemical compound with the molecular formula C5H12O2 and a molecular weight of 114.21 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5-decadeuteriopentane-1,5-diol. InChIKey: ALQSHHUCVQOPAS-YXALHFAPSA-N.
| Molecular formula | C5H12O2 |
|---|---|
| Molecular weight | 114.21 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5-decadeuteriopentane-1,5-diol |
| InChIKey | ALQSHHUCVQOPAS-YXALHFAPSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])C([2H])([2H])O)C([2H])([2H])C([2H])([2H])O |
Computed by PubChem (NCBI)