Products 1219804-53-1
CAS 1219804-53-1 appears in our catalog under these names: 2-Methyl-1-propanol-d7, 2–Methyl–1–propanol–d7, 2-Methyl-d3-propyl-2,3,3,3-d4 Alcohol, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, GLPBio, CDN. Available pack sizes: 50mg, 0,5g, 0,25g.
2,3,3,3-tetradeuterio-2-(trideuteriomethyl)propan-1-ol (CAS 1219804-53-1) is a chemical compound with the molecular formula C4H10O and a molecular weight of 81.16 g/mol. IUPAC name: 2,3,3,3-tetradeuterio-2-(trideuteriomethyl)propan-1-ol. InChIKey: ZXEKIIBDNHEJCQ-UAVYNJCWSA-N.
| Molecular formula | C4H10O |
|---|---|
| Molecular weight | 81.16 g/mol |
| IUPAC name | 2,3,3,3-tetradeuterio-2-(trideuteriomethyl)propan-1-ol |
| InChIKey | ZXEKIIBDNHEJCQ-UAVYNJCWSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(CO)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)