Products 1219804-61-1
CAS 1219804-61-1 is the registry number for 2,4,5-Trichloroaniline-d4, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,05g.
2,4,5-trichloro-N,N,3,6-tetradeuterioaniline (CAS 1219804-61-1) is a chemical compound with the molecular formula C6H4Cl3N and a molecular weight of 200.5 g/mol. IUPAC name: 2,4,5-trichloro-N,N,3,6-tetradeuterioaniline. InChIKey: GUMCAKKKNKYFEB-OPTZXGQFSA-N.
| Molecular formula | C6H4Cl3N |
|---|---|
| Molecular weight | 200.5 g/mol |
| IUPAC name | 2,4,5-trichloro-N,N,3,6-tetradeuterioaniline |
| InChIKey | GUMCAKKKNKYFEB-OPTZXGQFSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Cl)Cl)[2H])Cl)N([2H])[2H] |
Computed by PubChem (NCBI)