Products 1219804-77-9

CAS 1219804-77-9 is the registry number for 2-Fluoroaniline-4,6-d2,ND2, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

N,N,2,4-tetradeuterio-6-fluoroaniline (CAS 1219804-77-9) is a chemical compound with the molecular formula C6H6FN and a molecular weight of 115.14 g/mol. IUPAC name: N,N,2,4-tetradeuterio-6-fluoroaniline. InChIKey: FTZQXOJYPFINKJ-PRAYLXBLSA-N.

Identity
Molecular formulaC6H6FN
Molecular weight115.14 g/mol
IUPAC nameN,N,2,4-tetradeuterio-6-fluoroaniline
InChIKeyFTZQXOJYPFINKJ-PRAYLXBLSA-N
SMILES[2H]C1=CC(=C(C(=C1)F)N([2H])[2H])[2H]

Computed by PubChem (NCBI)