CAS 1219804-77-9 is the registry number for 2-Fluoroaniline-4,6-d2,ND2, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
N,N,2,4-tetradeuterio-6-fluoroaniline (CAS 1219804-77-9) is a chemical compound with the molecular formula C6H6FN and a molecular weight of 115.14 g/mol. IUPAC name: N,N,2,4-tetradeuterio-6-fluoroaniline. InChIKey: FTZQXOJYPFINKJ-PRAYLXBLSA-N.
| Molecular formula | C6H6FN |
|---|---|
| Molecular weight | 115.14 g/mol |
| IUPAC name | N,N,2,4-tetradeuterio-6-fluoroaniline |
| InChIKey | FTZQXOJYPFINKJ-PRAYLXBLSA-N |
| SMILES | [2H]C1=CC(=C(C(=C1)F)N([2H])[2H])[2H] |
Computed by PubChem (NCBI)